L-2-Amino-4-pentenoic acid
(S)-(-)-2-Amino-4-pentenoic acid
CAS: 16338-48-0
Molecular Formula: C5H9NO2
L-2-Amino-4-pentenoic acid - Names and Identifiers
| Name | (S)-(-)-2-Amino-4-pentenoic acid |
| Synonyms | L-Allylglycine H-(Allyl)Gly-Oh H-(ALLYL)GLY-OH H-Gly(Allyl)-Oh L-C-Allylglycine L-C-ALLYLGLYCINE 3-VINYL-L-ALANINE 3-Vinyl-L-Alanine L-ALPHA-ALLYL-GLY L-Alpha-Allyl-Gly RARECHEM BK PT 0249 L-ALPHA-ALLYL-GLYCINE L-Alpha-Allyl-Glycine L-2-Amino-4-pentenoic acid (S)-2-Amino-4-Pentenoic Acid (S)-2-AMINO-4-PENTENOIC ACID (S)-2-Aminopent-4-enoic acid (2S)-2-Aminopent-4-Enoic Acid (S)-(-)-2-Amino-4-pentenoic acid (S)-(-)-2-AMINO-4-PENTENOIC ACID |
| CAS | 16338-48-0 |
| InChI | InChI=1/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8)/t4-/m0/s1 |
| InChIKey | WNNNWFKQCKFSDK-SCSAIBSYSA-N |
L-2-Amino-4-pentenoic acid - Physico-chemical Properties
| Molecular Formula | C5H9NO2 |
| Molar Mass | 115.13 |
| Density | 1.1808 (rough estimate) |
| Melting Point | 283°C (dec.)(lit.) |
| Boling Point | 215.41°C (rough estimate) |
| Specific Rotation(α) | -37 º (c=4, H2O) |
| Flash Point | 93.5°C |
| Water Solubility | soluble |
| Solubility | H2O: 100mg/mL |
| Vapor Presure | 0.0226mmHg at 25°C |
| Appearance | White to off-white crystalline powder |
| Color | white |
| BRN | 1721512 |
| pKa | 2.22±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.4538 (estimate) |
| MDL | MFCD00002627 |
| Physical and Chemical Properties | Solubility: H2O: 100 mg/mL storage condition: 2-8 ℃ WGK Germany:3 |
L-2-Amino-4-pentenoic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29224999 |
L-2-Amino-4-pentenoic acid - Introduction
(S)-(-)-2-Amino-4-pentenoic acid, also known as D-proline or D-2-amino-4-pentenoic acid, is a naturally occurring amino acid. It has the following properties:
1. Appearance: white crystalline powder.
2. Solubility: soluble in water and alcohol, almost insoluble in non-polar solvents.
3. Melting Point: about 300 ℃.
The main uses of (S)-(-)-2-Amino-4-pentenoic acid include:
1. Drug synthesis: It is an important intermediate for the synthesis of a variety of drugs, such as antibiotics, antihypertensive drugs and antineoplastic drugs.
2. Health care: As a nutritional supplement, it can be used in the production of protein nutritional supplements and biological agents.
in terms of preparation method, (S)-(-)-2-Amino-4-pentenoic acid is generally extracted from natural microorganisms by fermentation method.
Regarding safety information,(S)-(-)-2-Amino-4-pentenoic acid is generally considered to be relatively safe, but the following points still need to be paid attention:
1. Eye contact: avoid contact with eyes, such as accidental contact with eyes, should immediately rinse with plenty of water and seek medical help.
2. Avoid inhalation and intake: should avoid inhalation (S)-(-)-2-Amino-4-pentenoic acid powder, and pay attention to avoid eating. If ingested or inhaled too much, seek medical attention immediately.
3. Storage and handling: should be stored in a dry, well-ventilated place, away from fire and oxidant. When handling, appropriate personal protective measures should be taken, such as wearing protective glasses, gloves and masks.
1. Appearance: white crystalline powder.
2. Solubility: soluble in water and alcohol, almost insoluble in non-polar solvents.
3. Melting Point: about 300 ℃.
The main uses of (S)-(-)-2-Amino-4-pentenoic acid include:
1. Drug synthesis: It is an important intermediate for the synthesis of a variety of drugs, such as antibiotics, antihypertensive drugs and antineoplastic drugs.
2. Health care: As a nutritional supplement, it can be used in the production of protein nutritional supplements and biological agents.
in terms of preparation method, (S)-(-)-2-Amino-4-pentenoic acid is generally extracted from natural microorganisms by fermentation method.
Regarding safety information,(S)-(-)-2-Amino-4-pentenoic acid is generally considered to be relatively safe, but the following points still need to be paid attention:
1. Eye contact: avoid contact with eyes, such as accidental contact with eyes, should immediately rinse with plenty of water and seek medical help.
2. Avoid inhalation and intake: should avoid inhalation (S)-(-)-2-Amino-4-pentenoic acid powder, and pay attention to avoid eating. If ingested or inhaled too much, seek medical attention immediately.
3. Storage and handling: should be stored in a dry, well-ventilated place, away from fire and oxidant. When handling, appropriate personal protective measures should be taken, such as wearing protective glasses, gloves and masks.
Last Update：2024-04-09 21:50:46
Supplier List
Spot supply
Product Name: (S)-(-)-2-Amino-4-Pentenoic Acid Visit Supplier Webpage Request for quotationCAS: 16338-48-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: (S)-(-)-2-Amino-4-Pentenoic Acid Visit Supplier Webpage Request for quotationCAS: 16338-48-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History